2-oxa-6-azaspiro[3.4]octane manufacturers
|
| | 2-oxa-6-azaspiro[3.4]octane Basic information |
| Product Name: | 2-oxa-6-azaspiro[3.4]octane | | Synonyms: | 2-oxa-6-azaspiro[3.4]octane;2-Oxa-6-azaspiro[3.4]octa...;2-oxa-6-azaspiro[3.4]octane, hemioxalate salt;2-Oxa-6-azaspiro[3.4]octane,95%;2-oxa-7-azaspiro[3.4]octane;2-Oxa-6-azaspiro[3.4]octane (9CI, ACI) | | CAS: | 220290-68-6 | | MF: | C6H11NO | | MW: | 113.16 | | EINECS: | | | Product Categories: | | | Mol File: | 220290-68-6.mol | ![2-oxa-6-azaspiro[3.4]octane Structure](CAS2/GIF/220290-68-6.gif) |
| | 2-oxa-6-azaspiro[3.4]octane Chemical Properties |
| Boiling point | 187℃ | | density | 1.08 | | Fp | 63°(145°F) | | storage temp. | 2-8°C(protect from light) | | pka | 10.55±0.20(Predicted) | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C6H11NO/c1-2-7-3-6(1)4-8-5-6/h7H,1-5H2 | | InChIKey | ZHAIMJRKJKQNQI-UHFFFAOYSA-N | | SMILES | C1C2(CCNC2)CO1 |
| | 2-oxa-6-azaspiro[3.4]octane Usage And Synthesis |
| Uses | 2-Oxa-6-azaspiro[3.4]octane is involved in the preparation of azaspirocycle or azetidine substituted 4-anilinoquinazoline derivatives, which exhibits epidermal growth factor receptor (EGFR) inhibitory activities. | | Application | 2-Oxa-6-Azaspiro[3.4]Octane Hydrochloride may be useful in the preparation of aminocyanopyridine derivatives for the prevention or treatment of cancer or inflammatory diseases. | | Synthesis | Tert-butyl 2-oxa-6-azaspiro[3.4]octane-6-carboxylate (86mg, 0.4mmol) was dissolved in dichloromethane (1mL), trifluoroacetic acid (2mL) was added to the system at room temperature, and the reaction solution was heated at 60°C for 2h. The reaction solution was cooled to room temperature and concentrated under reduced pressure to obtain crude product 2-oxa-6-azaspiro[3.4]octane.
![2-oxa-6-azaspiro[3.4]octane](/NewsImg/2023-10-20/6383340614380040227619222.jpg "2-oxa-6-azaspiro[3.4]octane") |
| | 2-oxa-6-azaspiro[3.4]octane Preparation Products And Raw materials |
|