- TIMTEC-BB SBB002944
-
- $1.00 / 1KG
-
2020-02-17
- CAS:63134-33-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kgs
|
| | 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone Basic information |
| Product Name: | 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone | | Synonyms: | 4-BENZYLOXYPHENYL 4-HYDROXYPHENYL SULFONE;4-BENZYLOXYPHENYL-4'-HYDROXYPHENYLSULFONE;4-HYDROXY-4'-BENZYLOXY DIPHENYL SULFONE;p-[[p-benzyloxyphenyl]sulphonyl]phenol;4-benzyloxy-4-hydroxydiphenyl sulphone;4-((4-(PHENYLMETHOXY)PHENYL)SULPHONYL)PHENOL;4-[(4-Benzyloxyphenyl)sulfonyl]phenol;4-[[4-(Phenylmethoxy)phenyl]sulfonyl]phenol | | CAS: | 63134-33-8 | | MF: | C19H16O4S | | MW: | 340.39 | | EINECS: | 263-920-3 | | Product Categories: | | | Mol File: | 63134-33-8.mol |  |
| | 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone Chemical Properties |
| Melting point | 170 °C | | Boiling point | 558.6±40.0 °C(Predicted) | | density | 1.304±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 7.23±0.15(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C19H16O4S/c20-16-6-10-18(11-7-16)24(21,22)19-12-8-17(9-13-19)23-14-15-4-2-1-3-5-15/h1-13,20H,14H2 | | InChIKey | UWPJWCBDMZHMTN-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(S(C2=CC=C(OCC3=CC=CC=C3)C=C2)(=O)=O)C=C1 | | CAS DataBase Reference | 63134-33-8(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-[[4-(phenylmethoxy)phenyl]sulfonyl]- (63134-33-8) |
| | 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone Usage And Synthesis |
| Uses | 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone is used in the synthesis of Bis(4-hydroxyphenyl) Sulfone O-b-D-Glucuronide (B447395), which is a compound that is commonly used as a reactant in epoxy reactions. It is also used as a latent thermal catalyst for epoxy resin. |
| | 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone Preparation Products And Raw materials |
|