| Identification | Back Directory | [Name]
4,5-Difluorophthalic acid | [CAS]
18959-31-4 | [Synonyms]
4,5-Difluorophthalicaci
4,5-Difluorophthalic acid
4,5-Difluorobenzene-1,2-dicarboxylic acid
1,2-Benzenedicarboxylic acid, 4,5-difluoro- | [Molecular Formula]
C8H4F2O4 | [MDL Number]
MFCD00077514 | [MOL File]
18959-31-4.mol | [Molecular Weight]
202.11 |
| Chemical Properties | Back Directory | [Melting point ]
161.5-162 °C | [Boiling point ]
378.7±42.0 °C(Predicted) | [density ]
1.644±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,Room Temperature | [pka]
2.55±0.10(Predicted) | [InChI]
InChI=1S/C8H4F2O4/c9-5-1-3(7(11)12)4(8(13)14)2-6(5)10/h1-2H,(H,11,12)(H,13,14) | [InChIKey]
FFSBOABNRUJQFW-UHFFFAOYSA-N | [SMILES]
C1(C(O)=O)=CC(F)=C(F)C=C1C(O)=O |
| Hazard Information | Back Directory | [Uses]
4,5-difluorophthalic acid can be used to prepare a polyguanidine bactericidal compound miscible with anionic surfactants. 4,5-difluorophthalic acid is used to modify the PHMB molecule so that it has multiple carboxyl groups at the ends and has amphoteric surfactant properties. |
|
|