Cas No.: | 1539314-06-1 |
Chemical Name: | (R)-1-[1-(Methylsulfonyl)propan-2-yl]-4-(trifluoromethyl)-1H-indole-5-carbonitrile |
Synonyms: | GSK2881078,GSK-2881078,GSK 2881078 |
SMILES: | C(C(F)(F)F)1=C(C#N)C=CC2N([C@H](CS(=O)(=O)C)C)C=CC1=2 |
Formula: | C14H13NF3N2O2S |
M.Wt: | 330.33 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | GSK 2881078 is a selective androgen receptor modulator potentially for the treatment of cachexia.GSK 2881078 is a selective androgen receptor modulator (SARM) that is being evaluated for effects on muscle growth and strength in subjects with muscle wasting to improve their physical function. |