|
|
| | 6-Methyleneandrost-4-ene-3,17-dione Basic information |
| Product Name: | 6-Methyleneandrost-4-ene-3,17-dione | | Synonyms: | 6-Methyleneandrost-4-ene-3,7-dione;Androst-4-ene-3,17-dione-6-methylene;Exemestane Related Compound A (15 mg) (6-Methyleneandrosta-4-ene-3,17-dione);1,2-Dihydro ExeMestane;6-Methyleneandrost-4-en-3,17-dione;ExeMestane Related CoMpound A;6-Methylene-4-androstene-3,17-dione;6-Methylene-4-Androsten-3,17-dione | | CAS: | 19457-55-7 | | MF: | C20H26O2 | | MW: | 298.42 | | EINECS: | | | Product Categories: | steroids;API | | Mol File: | 19457-55-7.mol |  |
| | 6-Methyleneandrost-4-ene-3,17-dione Chemical Properties |
| Melting point | 163-165 °C | | Boiling point | 450.8±45.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Chloroform (Sparingly), DMSO (Heated), Methanol (Slightly) | | form | Solid | | color | Pale Yellow to Light Beige | | InChI | InChI=1S/C20H26O2/c1-12-10-14-15-4-5-18(22)20(15,3)9-7-16(14)19(2)8-6-13(21)11-17(12)19/h11,14-16H,1,4-10H2,2-3H3/t14-,15-,16-,19+,20-/m0/s1 | | InChIKey | KQRGETZTRARSMA-DAELLWKTSA-N | | SMILES | C1(=O)C=C2[C@](C)(CC1)[C@]1([H])[C@]([H])([C@@]3([H])[C@@](CC1)(C)C(=O)CC3)CC2=C |
| | 6-Methyleneandrost-4-ene-3,17-dione Usage And Synthesis |
| Uses | 1,2-Dihydro Exemestane is a related compound of Exemestane (E957000). |
| | 6-Methyleneandrost-4-ene-3,17-dione Preparation Products And Raw materials |
|