DMT-dI Phosphoramidite manufacturers
- DMT-dI-CE
-
- $0.00 / 100mg
-
2024-08-08
- CAS:141684-35-7
- Min. Order: 100mg
- Purity: ≥99%
- Supply Ability: 20tons
|
| | DMT-dI Phosphoramidite Basic information |
| Product Name: | DMT-dI Phosphoramidite | | Synonyms: | DEOXYINOSINE-CE PHOSPHORAMIDITE FORBIOSE ARCH 8000;5'-O-DMT-2'-deoxyinosine-3'-CE Phosphoramidite;deoxyinosine-ce phosphoramidite*for cyclone;DEOXYINOSINE CYANOETHYL PHOSPHORAMIDITE;N-blocked-5'-O-DMT 3'-CED deoxyinosine phosphoramidite;DMT-dI Phosphoramidite;5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-2'-deoxyinosine 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite];(2R,3S,5R)-2-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-5-(6-hydroxy-9H-purin-9-yl)tetrahydrofuran-3-yl (2-cyanoethyl) diisopropylphosphoramidite | | CAS: | 141684-35-7 | | MF: | C40H47N6O7P | | MW: | 754.81 | | EINECS: | | | Product Categories: | Phosphoramidite | | Mol File: | 141684-35-7.mol |  |
| | DMT-dI Phosphoramidite Chemical Properties |
| Boiling point | 857.1±65.0 °C(Predicted) | | storage temp. | -20°C | | pka | 8.92±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChIKey | ZKGZROFWRPJVEB-XZYUMQGLSA-N | | SMILES | O(C(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=CC=C1)C[C@H]1O[C@@H](N2C3C(=C(N=CN=3)O)N=C2)C[C@@H]1OP(N(C(C)C)C(C)C)OCCC#N |
| | DMT-dI Phosphoramidite Usage And Synthesis |
| Definition |
Deoxyinosine is a minor base that is encountered in natural nucleic acids. It forms base pairs with A, C and T/U bases. The modified DNA oligonucleotides containing 2'-deoxyinosine can be synthesized using this phosphoramidite.
| | storage |
4°C, sealed storage, away from moisture and light
In solvent : -80°C, 6 months; -20°C, 1 month (sealed storage, away from moisture and light)
|
| | DMT-dI Phosphoramidite Preparation Products And Raw materials |
|