|
| 7-chloro-1H-imidazo[4,5-b]pyridine Basic information |
| 7-chloro-1H-imidazo[4,5-b]pyridine Chemical Properties |
Melting point | >164°C (dec.) | Boiling point | 396.5±22.0 °C(Predicted) | density | 1.531±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | DMSO, Methanol | pka | 7.93±0.40(Predicted) | form | Solid | color | Beige to Light Orange | InChI | InChI=1S/C6H4ClN3/c7-4-1-2-8-6-5(4)9-3-10-6/h1-3H,(H,8,9,10) | InChIKey | HAWCUEYFSQKISQ-UHFFFAOYSA-N | SMILES | C12NC=NC1=C(Cl)C=CN=2 |
| 7-chloro-1H-imidazo[4,5-b]pyridine Usage And Synthesis |
Physical properties | Beige to light orange solid | Uses | 7-Chloro-3H-imidazo[4,5-b]pyridine is used as a reagent in the synthesis of purine derived S-adenosylhomocysteine/methylthioadenosine nucleosidase inhibitors which display antimicrobial activity. Also used as highly selective CYP3A4 inhibitors. |
| 7-chloro-1H-imidazo[4,5-b]pyridine Preparation Products And Raw materials |
|