|
|
| | 4,4'-Dimethylbenzophenone Basic information |
| | 4,4'-Dimethylbenzophenone Chemical Properties |
| Melting point | 90-93 °C(lit.) | | Boiling point | 200 °C17 mm Hg(lit.) | | density | 1.0232 (rough estimate) | | refractive index | 1.5361 (estimate) | | Fp | 200°C/17mm | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder | | color | Pale brown | | Water Solubility | Insoluble in water. | | BRN | 1240527 | | InChI | InChI=1S/C15H14O/c1-11-3-7-13(8-4-11)15(16)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | | InChIKey | ZWPWLKXZYNXATK-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)=O | | CAS DataBase Reference | 611-97-2(CAS DataBase Reference) | | NIST Chemistry Reference | | | EPA Substance Registry System | Methanone, bis(4-methylphenyl)- (611-97-2) |
| | 4,4'-Dimethylbenzophenone Usage And Synthesis |
| Chemical Properties | Pale brown crystalline powder | | Uses | 4,4'-Dimethylbenzophenone is used as catalytic agent and petrochemical additive. It is also used as pharmaceutical intermediates. | | Synthesis Reference(s) | Tetrahedron, 50, p. 12821, 1994 DOI: 10.1016/S0040-4020(01)81203-5
Tetrahedron Letters, 27, p. 3911, 1986 DOI: 10.1016/S0040-4039(00)83914-3 | | General Description | 4,4′-Dimethylbenzophenone reacts with bis(trichlorotitanium phenoxide), a bidentate Lewis acid, to form a crystalline complex. | | Purification Methods | Purify the benzophenone by zone refining or distllation, preferably in a vacuum. [Beilstein 7 III 2181, 7 IV 1434.] |
| | 4,4'-Dimethylbenzophenone Preparation Products And Raw materials |
|