|
|
| | 1-Chloroethyl isopropyl carbonate Basic information |
| | 1-Chloroethyl isopropyl carbonate Chemical Properties |
| Boiling point | 70 °C / 15mmHg | | density | 1.113±0.06 g/cm3(Predicted) | | refractive index | 1.4110-1.4150 | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | InChI | InChI=1S/C6H11ClO3/c1-4(2)9-6(8)10-5(3)7/h4-5H,1-3H3 | | InChIKey | XPTPAIJDVFQPJT-UHFFFAOYSA-N | | SMILES | C(OC(C)C)(=O)OC(Cl)C | | LogP | 1.37 at 20℃ | | CAS DataBase Reference | 98298-66-9(CAS DataBase Reference) |
| Risk Statements | 10-34 | | Safety Statements | 16-36/37/39 | | RIDADR | 2920 | | HS Code | 2915.90.5010 | | HazardClass | 8/3 | | PackingGroup | II |
| | 1-Chloroethyl isopropyl carbonate Usage And Synthesis |
| Uses |
1-Chloroethyl Isopropyl-d7 Carbonate is an intermediate in the synthesis of Cefpodoxime Proxetil-d7 (C243862). Cefpodoxime Proxetil-d7 is the labelled form of Cefpodoxime Proxetil (C243860), an antibacterial. Cefpodoxime Proxetil is a broad spectrum, orally absorbed third generation cephalosporin, ester prodrug of the active free acid metabolite, Cefpodoxime (C243850).
1-Chloroethyl isopropyl carbonate is an efficient and mild reagent for removing benzyl protecting groups, especially for compounds containing functional groups that are easily reduced.
| | Synthesis | To a solution of 2-propanol (2.66 mL, 34.97 mmol) and pyridine (3.39 mL, 41.96 mmol), pre-cooled in a dry-ice/acetone bath was slowly added 1-chloroethyl chloroformate. The resulting mixture was allowed to slowly warm to 25° C. overnight, with stirring. After concentration under reduced pressure, the mixture was dissolved in ethyl acetate. The organic layer was washed with brine, dried over sodium sulfate, filtered and concentrated under reduced pressure to give 1-chloroethyl isopropyl carbonate as a pink/orange oil (5.11 g, 88% yield). |
| | 1-Chloroethyl isopropyl carbonate Preparation Products And Raw materials |
|