|
|
| | Methyl 1H-indazole-6-carboxylate Basic information |
| Product Name: | Methyl 1H-indazole-6-carboxylate | | Synonyms: | 1H-Indazole-6-carboxylic acid Methyl ester;1H-Indazole-6-carboxylic acid methyl ester;METHYL 1H-INDAZOLE-6-CARBOXYLATE;INDAZOLE-6-CARBOXYLIC ACID METHYL ESTER;6-(1H)INDAZOLE CARBOXYLIC ACID METHYL ESTER;1H-Indazole-6-carboxylic acid methyl ester;Methyl indazole-6-carboxylate;Methyl indazole-6-carboxy... | | CAS: | 170487-40-8 | | MF: | C9H8N2O2 | | MW: | 176.17 | | EINECS: | | | Product Categories: | | | Mol File: | 170487-40-8.mol |  |
| | Methyl 1H-indazole-6-carboxylate Chemical Properties |
| Melting point | 142-144℃ | | Boiling point | 345.2±15.0 °C(Predicted) | | density | 1.324±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | form | powder to crystal | | pka | 12.43±0.40(Predicted) | | color | White to Light yellow to Light orange | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C9H8N2O2/c1-13-9(12)6-2-3-7-5-10-11-8(7)4-6/h2-5H,1H3,(H,10,11) | | InChIKey | TUSICEWIXLMXEY-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(C(OC)=O)=C2)C=N1 |
| WGK Germany | 3 | | HS Code | 2933998090 |
| | Methyl 1H-indazole-6-carboxylate Usage And Synthesis |
| Uses | Methyl 1H-indazole-6-carboxylate?is used in organic synthesis. |
| | Methyl 1H-indazole-6-carboxylate Preparation Products And Raw materials |
|