- Fmoc-Aib-OH
-
- $0.00/ kg
-
2024-11-14
- CAS:94744-50-0
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T
- Fmoc-Aib-OH
-
- $1.00 / 1g
-
2020-01-06
- CAS:94744-50-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
- Fmoc-Aib-OH
-
- $1.00 / 1KG
-
2019-07-06
- CAS:94744-50-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
|
| | Fmoc-Aib-OH Basic information |
| | Fmoc-Aib-OH Chemical Properties |
| Melting point | 182-188 °C | | Boiling point | 544.3±33.0 °C(Predicted) | | density | 1.256±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | pka | 3.98±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Sensitive | Moisture Sensitive | | BRN | 5604328 | | InChI | InChI=1S/C19H19NO4/c1-19(2,17(21)22)20-18(23)24-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,16H,11H2,1-2H3,(H,20,23)(H,21,22) | | InChIKey | HOZZVEPRYYCBTO-UHFFFAOYSA-N | | SMILES | C(O)(=O)[C@](C)(C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | | CAS DataBase Reference | 94744-50-0(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | Fmoc-Aib-OH Usage And Synthesis |
| Chemical Properties | Fmoc-Aib-OH is beige powder | | Uses | L-Fmoc-Aminobutyric Acid, is an alanine derivative used in chemical synthesis and peptide chemistry. | | Uses | Fmoc-Aib-OH is used for studying receptor-ligand interactions using encoded amino acid scanning. |
| | Fmoc-Aib-OH Preparation Products And Raw materials |
|