1-Bromo-8-chlorodibenzo[b,d]furan manufacturers
|
| 1-Bromo-8-chlorodibenzo[b,d]furan Basic information |
| 1-Bromo-8-chlorodibenzo[b,d]furan Chemical Properties |
Boiling point | 376.4±22.0 °C(Predicted) | density | 1.669±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | InChI | InChI=1S/C12H6BrClO/c13-9-2-1-3-11-12(9)8-6-7(14)4-5-10(8)15-11/h1-6H | InChIKey | LMGAQFSQAOXEDZ-UHFFFAOYSA-N | SMILES | O1C2=CC=C(Cl)C=C2C2=C(Br)C=CC=C12 |
| 1-Bromo-8-chlorodibenzo[b,d]furan Usage And Synthesis |
Uses | 1-Bromo-8-chlorodibenzo[b,d]furan is a notable chemical compound with significant organic synthesis and materials science applications. Its distinctive fused-ring structure, incorporating bromine and chlorine atoms, offers unique reactivity for various chemical transformations. This compound is a devate of Dibenzofuran and a good electron donor. |
| 1-Bromo-8-chlorodibenzo[b,d]furan Preparation Products And Raw materials |
|