|
|
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Basic information |
| Product Name: | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone | | Synonyms: | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone;Methanone, (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)-;(5-broMo-2-chlorophenyl)(4-ethoxyphenyl)-;5-broMo-2-chloro-4'-ethoxybenzophenone;(5-BroMo-2-chlorophenyl)(4-ethoxypheny)Methanone;Dapagliflozin iMpurity A;Dapagliflozin Impurity 18;Dapagliflozin Intermediate I | | CAS: | 461432-22-4 | | MF: | C15H12BrClO2 | | MW: | 339.61 | | EINECS: | 630-623-9 | | Product Categories: | API intermediates;API | | Mol File: | 461432-22-4.mol |  |
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Chemical Properties |
| Boiling point | 439.2±40.0 °C(Predicted) | | density | 1.437 | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Low-Melting Solid | | color | Off-White to Pale Yellow | | InChI | InChI=1S/C15H12BrClO2/c1-2-19-12-6-3-10(4-7-12)15(18)13-9-11(16)5-8-14(13)17/h3-9H,2H2,1H3 | | InChIKey | OEURLNJEQCLGPS-UHFFFAOYSA-N | | SMILES | C(C1=CC(Br)=CC=C1Cl)(C1=CC=C(OCC)C=C1)=O | | CAS DataBase Reference | 461432-22-4 |
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Usage And Synthesis |
| Uses | (5-Bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone is an intermediate used in the improved synthesis of Dapagliflozin, a novel selective sodium-glucose co-transporter type II (SGLT2) inhibitor. |
| | (5-bromo-2-chlorophenyl)(4-ethoxyphenyl)methanone Preparation Products And Raw materials |
|