Identification | Back Directory | [Name]
5-Bromo-4-fluoro-1-methyl-1H-indazole | [CAS]
1784678-61-0 | [Synonyms]
5-Bromo-4-fluoro-1-methylindazole 5-Bromo-4-fluoro-1-methyl-1H-indazole 1H-Indazole, 5-bromo-4-fluoro-1-methyl- | [Molecular Formula]
C8H6BrFN2 | [MDL Number]
MFCD30475009 | [MOL File]
1784678-61-0.mol | [Molecular Weight]
229.05 |
Chemical Properties | Back Directory | [Boiling point ]
293.4±20.0 °C(Predicted) | [density ]
1.70±0.1 g/cm3(Predicted) | [pka]
-0.38±0.30(Predicted) | [InChI]
InChI=1S/C8H6BrFN2/c1-12-7-3-2-6(9)8(10)5(7)4-11-12/h2-4H,1H3 | [InChIKey]
ANLXRMBQONDZBQ-UHFFFAOYSA-N | [SMILES]
N1(C)C2=C(C(F)=C(Br)C=C2)C=N1 |
Hazard Information | Back Directory | [Uses]
5-Bromo-4-fluoro-1-methyl-1H-indazole is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
|
|
|