| Identification | Back Directory | [Name]
10H-spiro[acridine-9,9'-xanthene] | [CAS]
1443130-79-7 | [Synonyms]
spiro[10H-acridine-9,9'-xanthene
10H-spiro[acridine-9,9'-xanthene] | [Molecular Formula]
C25H17NO | [MOL File]
1443130-79-7.mol | [Molecular Weight]
347.41 |
| Chemical Properties | Back Directory | [Boiling point ]
497.2±45.0 °C(Predicted) | [density ]
1.33±0.1 g/cm3(Predicted) | [pka]
1.11±0.20(Predicted) | [InChI]
InChI=1S/C25H17NO/c1-5-13-21-17(9-1)25(18-10-2-6-14-22(18)26-21)19-11-3-7-15-23(19)27-24-16-8-4-12-20(24)25/h1-16,26H | [InChIKey]
LRDZIHIBFOPYFK-UHFFFAOYSA-N | [SMILES]
C1=C2C(NC3=C(C42C2=C(C=CC=C2)OC2=C4C=CC=C2)C=CC=C3)=CC=C1 |
| Hazard Information | Back Directory | [Description]
10H-spiro[acridine-9,9'-xanthene] is a a weak electron donor moiety. Its structure is similar to spiro[acridine-9,90
-fluorene] and their properties are similar.They all have effective donor properties and the expectation of
a large dihedral angle arising from steric repulsion by the
two H atoms in the peri-position. Hence, they are often used simultaneously to synthesize tdf and compare the properties of the two synthesized materials. | [Uses]
10H-spiro[acridine-9,9'-xanthene] could used as an intermediates of photoelectric materials to fabricate a TADF OLED emitter. Since its good donor properties and the expectation of a large dihedral angle arising from steric repulsion by the two H atoms in the peri-position, it was commonly selected as a wide-gap donor moiety to fabricate highly efficient blue TADF materials whit diphenylsulphone (DPS) as an electron acceptor[1]. 10H-spiro[acridine-9,9'-xanthene] is also used to construct phosphine oxide (PO) hosts through introducing one or two diphenylphosphine oxide groups at 2 and 7 positions of acridine ring, respectively. This material could used to fabricate single-emissive-layer Thermally activated delayed fluorescence (TADF) white organic light-emitting diodes[2]. |
|
| Company Name: |
DebyeTec.com Inc.
|
| Tel: |
18086626237 18086626237 |
| Website: |
https://www.debyetec.com |
| Company Name: |
Fuxin Pharmaceutical
|
| Tel: |
021-50872116 13611907556 |
| Website: |
https://www.fuxinpharm.com |
|